Products 1160249-51-3

CAS 1160249-51-3 is the registry number for 2-(Benzyloxy)-5-bromobenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-bromo-2-phenylmethoxybenzoyl chloride (CAS 1160249-51-3) is a chemical compound with the molecular formula C14H10BrClO2 and a molecular weight of 325.58 g/mol. IUPAC name: 5-bromo-2-phenylmethoxybenzoyl chloride. InChIKey: PLMYJXRFBVUZFL-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10BrClO2
Molecular weight325.58 g/mol
IUPAC name5-bromo-2-phenylmethoxybenzoyl chloride
InChIKeyPLMYJXRFBVUZFL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C=C(C=C2)Br)C(=O)Cl

Computed by PubChem (NCBI)