CAS 333361-49-2 appears in our catalog under these names: (5-Bromo-2-chlorophenyl)(4-methoxyphenyl)methanone, >98.0%(HPLC)(qNMR), (5-Bromo-2-chlorophenyl)(4-methoxyphenyl)methanone, 98.0%, 98.0%. Offered by: TCI, Chemat. Available pack sizes: 1g.
(5-bromo-2-chlorophenyl)-(4-methoxyphenyl)methanone (CAS 333361-49-2) is a chemical compound with the molecular formula C14H10BrClO2 and a molecular weight of 325.58 g/mol. IUPAC name: (5-bromo-2-chlorophenyl)-(4-methoxyphenyl)methanone. InChIKey: NIEQZZXEZYUFMQ-UHFFFAOYSA-N.
| Molecular formula | C14H10BrClO2 |
|---|---|
| Molecular weight | 325.58 g/mol |
| IUPAC name | (5-bromo-2-chlorophenyl)-(4-methoxyphenyl)methanone |
| InChIKey | NIEQZZXEZYUFMQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)