Products 1160253-81-5
CAS 1160253-81-5 appears in our catalog under these names: 2-(4-Ethoxyphenyl)-6-methylquinoline-4-carbonyl chloride, 95%, 2-(4-Ethoxyphenyl)-6-methylquinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(4-ethoxyphenyl)-6-methylquinoline-4-carbonyl chloride (CAS 1160253-81-5) is a chemical compound with the molecular formula C19H16ClNO2 and a molecular weight of 325.8 g/mol. IUPAC name: 2-(4-ethoxyphenyl)-6-methylquinoline-4-carbonyl chloride. InChIKey: OKCRQBAYPMMSNZ-UHFFFAOYSA-N.
| Molecular formula | C19H16ClNO2 |
|---|---|
| Molecular weight | 325.8 g/mol |
| IUPAC name | 2-(4-ethoxyphenyl)-6-methylquinoline-4-carbonyl chloride |
| InChIKey | OKCRQBAYPMMSNZ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)C)C(=C2)C(=O)Cl |
Computed by PubChem (NCBI)