Products 895965-50-1
CAS 895965-50-1 appears in our catalog under these names: 2-(3-Chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylic acid, 95%, 2-(3-Chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylic acid (CAS 895965-50-1) is a chemical compound with the molecular formula C19H16ClNO2 and a molecular weight of 325.8 g/mol. IUPAC name: 2-(3-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylic acid. InChIKey: QEKRJLYSAKVGEV-UHFFFAOYSA-N.
| Molecular formula | C19H16ClNO2 |
|---|---|
| Molecular weight | 325.8 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylic acid |
| InChIKey | QEKRJLYSAKVGEV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=C(C(=N2)C3=CC(=CC=C3)Cl)C)C(=O)O)C |
Computed by PubChem (NCBI)