Products 1160257-94-2

CAS 1160257-94-2 is the registry number for 2-(4-Chloro-3,5-dimethylphenoxy)-2-methylpropanoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4-chloro-3,5-dimethylphenoxy)-2-methylpropanoyl chloride (CAS 1160257-94-2) is a chemical compound with the molecular formula C12H14Cl2O2 and a molecular weight of 261.14 g/mol. IUPAC name: 2-(4-chloro-3,5-dimethylphenoxy)-2-methylpropanoyl chloride. InChIKey: PAESUTRXEQZHQR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14Cl2O2
Molecular weight261.14 g/mol
IUPAC name2-(4-chloro-3,5-dimethylphenoxy)-2-methylpropanoyl chloride
InChIKeyPAESUTRXEQZHQR-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1Cl)C)OC(C)(C)C(=O)Cl

Computed by PubChem (NCBI)