Products 1178279-26-9
CAS 1178279-26-9 appears in our catalog under these names: 2-(3,4-Dichlorophenyl)-2-ethylbutanoic acid, 95%, 2-(3,4-Dichlorophenyl)-2-ethylbutanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-(3,4-dichlorophenyl)-2-ethylbutanoic acid (CAS 1178279-26-9) is a chemical compound with the molecular formula C12H14Cl2O2 and a molecular weight of 261.14 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-2-ethylbutanoic acid. InChIKey: PRLURMLDJMDTDM-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2O2 |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-2-ethylbutanoic acid |
| InChIKey | PRLURMLDJMDTDM-UHFFFAOYSA-N |
| SMILES | CCC(CC)(C1=CC(=C(C=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)