Products 1160261-32-4
CAS 1160261-32-4 appears in our catalog under these names: 2-(2-Chlorophenyl)-7,8-dimethylquinoline-4-carbonyl chloride, 95%, 2-(2-Chlorophenyl)-7,8-dimethylquinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(2-chlorophenyl)-7,8-dimethylquinoline-4-carbonyl chloride (CAS 1160261-32-4) is a chemical compound with the molecular formula C18H13Cl2NO and a molecular weight of 330.2 g/mol. IUPAC name: 2-(2-chlorophenyl)-7,8-dimethylquinoline-4-carbonyl chloride. InChIKey: QIHBALKKECVFHL-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl2NO |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-7,8-dimethylquinoline-4-carbonyl chloride |
| InChIKey | QIHBALKKECVFHL-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=N2)C3=CC=CC=C3Cl)C(=O)Cl)C |
Computed by PubChem (NCBI)