Products 1160262-96-3
CAS 1160262-96-3 appears in our catalog under these names: 2-(3-Isopropoxyphenyl)-6,8-dimethylquinoline-4-carbonyl chloride, 95%, 2-(3-Isopropoxyphenyl)-6,8-dimethylquinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6,8-dimethyl-2-(3-propan-2-yloxyphenyl)quinoline-4-carbonyl chloride (CAS 1160262-96-3) is a chemical compound with the molecular formula C21H20ClNO2 and a molecular weight of 353.8 g/mol. IUPAC name: 6,8-dimethyl-2-(3-propan-2-yloxyphenyl)quinoline-4-carbonyl chloride. InChIKey: YVMPITDCFPOPMF-UHFFFAOYSA-N.
| Molecular formula | C21H20ClNO2 |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 6,8-dimethyl-2-(3-propan-2-yloxyphenyl)quinoline-4-carbonyl chloride |
| InChIKey | YVMPITDCFPOPMF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C3=CC(=CC=C3)OC(C)C)C(=O)Cl)C |
Computed by PubChem (NCBI)