Products 957890-42-5
CAS 957890-42-5 appears in our catalog under these names: HIV-1 integrase inhibitor 2, 98.80%, 98.80%, LEDGIN6, 99.62%. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 10mM/1mL, 5 mg, 25 mg, 50 mg, 10 mg.
2-(6-chloro-2-methyl-4-phenylquinolin-3-yl)pentanoic acid (CAS 957890-42-5) is a chemical compound with the molecular formula C21H20ClNO2 and a molecular weight of 353.8 g/mol. IUPAC name: 2-(6-chloro-2-methyl-4-phenylquinolin-3-yl)pentanoic acid. InChIKey: XRPUJSGGRFQZPJ-UHFFFAOYSA-N.
| Molecular formula | C21H20ClNO2 |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 2-(6-chloro-2-methyl-4-phenylquinolin-3-yl)pentanoic acid |
| InChIKey | XRPUJSGGRFQZPJ-UHFFFAOYSA-N |
| SMILES | CCCC(C1=C(N=C2C=CC(=CC2=C1C3=CC=CC=C3)Cl)C)C(=O)O |
Computed by PubChem (NCBI)