CAS 1160294-93-8 appears in our catalog under these names: N-(4-Bromophenyl)-(1,1-biphenyl)-4-amine, >95% (HPLC), N–(4–Bromophenyl)–4–biphenylamine, N-(4-Bromophenyl)-4-biphenylamine, >98.0%(GC), N-(4-Bromophenyl)-4-biphenylamine 97%, N-(4-Bromophenyl)[1,1''-biphenyl]-4-amine, 97%, 97%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 500mg, 50mg, 25g, 5g, 1g, 250mg, 100g.
N-(4-bromophenyl)-4-phenylaniline (CAS 1160294-93-8) is a chemical compound with the molecular formula C18H14BrN and a molecular weight of 324.2 g/mol. IUPAC name: N-(4-bromophenyl)-4-phenylaniline. InChIKey: RDSXVQDXXSPFHG-UHFFFAOYSA-N.
| Molecular formula | C18H14BrN |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | N-(4-bromophenyl)-4-phenylaniline |
| InChIKey | RDSXVQDXXSPFHG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)