CAS 78600-33-6 appears in our catalog under these names: 3-Bromo-n,n-diphenylaniline, 95%, 3–Bromo–N,N–diphenylaniline, 3-Bromotriphenylamine, >98.0%(GC), 3-Bromo-N,N-diphenylaniline 99%, Benzenamine, 3-bromo-N,N-diphenyl-, 99%, 99%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
3-bromo-N,N-diphenylaniline (CAS 78600-33-6) is a chemical compound with the molecular formula C18H14BrN and a molecular weight of 324.2 g/mol. IUPAC name: 3-bromo-N,N-diphenylaniline. InChIKey: YDXLVFKTOSKBKT-UHFFFAOYSA-N.
| Molecular formula | C18H14BrN |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | 3-bromo-N,N-diphenylaniline |
| InChIKey | YDXLVFKTOSKBKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)