CAS 116050-35-2 appears in our catalog under these names: Diltiazem N,N-DiDesmethyl HCl, Diltiazem Impurity 6 HCl, Diltiazem Impurity 9, N,N-Didesmethyl Diltiazem Hydrochloride, >95% (HPLC), N,N-Didesmethyl diltiazem hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2S,3S)-5-(2-aminoethyl)-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate;hydrochloride (CAS 116050-35-2) is a chemical compound with the molecular formula C20H23ClN2O4S and a molecular weight of 422.9 g/mol. IUPAC name: [(2S,3S)-5-(2-aminoethyl)-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate;hydrochloride. InChIKey: AFGVHOBXBDWFNW-VOMIJIAVSA-N.
| Molecular formula | C20H23ClN2O4S |
|---|---|
| Molecular weight | 422.9 g/mol |
| IUPAC name | [(2S,3S)-5-(2-aminoethyl)-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate;hydrochloride |
| InChIKey | AFGVHOBXBDWFNW-VOMIJIAVSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](SC2=CC=CC=C2N(C1=O)CCN)C3=CC=C(C=C3)OC.Cl |
Computed by PubChem (NCBI)