CAS 940850-10-2 is the registry number for 2-(4-Chlorophenyl)-N-(2-methoxy-5-(piperidin-1-ylsulfonyl)phenyl)acetamide. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-chlorophenyl)-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)acetamide (CAS 940850-10-2) is a chemical compound with the molecular formula C20H23ClN2O4S and a molecular weight of 422.9 g/mol. IUPAC name: 2-(4-chlorophenyl)-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)acetamide. InChIKey: MOJFIWVSHAPUCY-UHFFFAOYSA-N.
| Molecular formula | C20H23ClN2O4S |
|---|---|
| Molecular weight | 422.9 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)acetamide |
| InChIKey | MOJFIWVSHAPUCY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)N2CCCCC2)NC(=O)CC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)