CAS 1160573-51-2 appears in our catalog under these names: 3,6-Dibromo-2,4-difluorobenzaldehyde, 95%, 3,6-Dibromo-2,4-difluorobenzaldehyde, 3,6-Dibromo-2,4-difluorobenzaldehyde 97%, 3,6-Dibromo-2,4-difluorobenzaldehyde, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 0,5g, 100mg, 250mg.
3,6-dibromo-2,4-difluorobenzaldehyde (CAS 1160573-51-2) is a chemical compound with the molecular formula C7H2Br2F2O and a molecular weight of 299.89 g/mol. IUPAC name: 3,6-dibromo-2,4-difluorobenzaldehyde. InChIKey: INWNDQDVNWEPAA-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2F2O |
|---|---|
| Molecular weight | 299.89 g/mol |
| IUPAC name | 3,6-dibromo-2,4-difluorobenzaldehyde |
| InChIKey | INWNDQDVNWEPAA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)C=O)F)Br)F |
Computed by PubChem (NCBI)