CAS 1805470-90-9 appears in our catalog under these names: 4,5-Dibromo-2,3-difluorobenzaldehyde, 95%, 4,5-Dibromo-2,3-difluorobenzaldehyde, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4,5-dibromo-2,3-difluorobenzaldehyde (CAS 1805470-90-9) is a chemical compound with the molecular formula C7H2Br2F2O and a molecular weight of 299.89 g/mol. IUPAC name: 4,5-dibromo-2,3-difluorobenzaldehyde. InChIKey: OMOFNDNSTFBMFY-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2F2O |
|---|---|
| Molecular weight | 299.89 g/mol |
| IUPAC name | 4,5-dibromo-2,3-difluorobenzaldehyde |
| InChIKey | OMOFNDNSTFBMFY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)F)F)C=O |
Computed by PubChem (NCBI)