CAS 1160573-65-8 appears in our catalog under these names: 1,3-Dibromo-4-iodo-5-methyl-2-nitrobenzene, 97%, 1,3-Dibromo-4-iodo-5-methyl-2-nitrobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1,3-dibromo-4-iodo-5-methyl-2-nitrobenzene (CAS 1160573-65-8) is a chemical compound with the molecular formula C7H4Br2INO2 and a molecular weight of 420.82 g/mol. IUPAC name: 1,3-dibromo-4-iodo-5-methyl-2-nitrobenzene. InChIKey: XAKBUBRMTYWTSB-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2INO2 |
|---|---|
| Molecular weight | 420.82 g/mol |
| IUPAC name | 1,3-dibromo-4-iodo-5-methyl-2-nitrobenzene |
| InChIKey | XAKBUBRMTYWTSB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1I)Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)