CAS 1160573-75-0 is the registry number for 1,3-Dibromo-2-iodo-5-methyl-4-nitrobenzene, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1,3-dibromo-2-iodo-5-methyl-4-nitrobenzene (CAS 1160573-75-0) is a chemical compound with the molecular formula C7H4Br2INO2 and a molecular weight of 420.82 g/mol. IUPAC name: 1,3-dibromo-2-iodo-5-methyl-4-nitrobenzene. InChIKey: VHRMPMPSCJDAPI-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2INO2 |
|---|---|
| Molecular weight | 420.82 g/mol |
| IUPAC name | 1,3-dibromo-2-iodo-5-methyl-4-nitrobenzene |
| InChIKey | VHRMPMPSCJDAPI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1[N+](=O)[O-])Br)I)Br |
Computed by PubChem (NCBI)