Products 1160573-88-5
CAS 1160573-88-5 is the registry number for 2-Bromo-3,5-dichloro-4-fluoroiodobenzene, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
4-bromo-1,3-dichloro-2-fluoro-5-iodobenzene (CAS 1160573-88-5) is a chemical compound with the molecular formula C6HBrCl2FI and a molecular weight of 369.78 g/mol. IUPAC name: 4-bromo-1,3-dichloro-2-fluoro-5-iodobenzene. InChIKey: JJZULRZPQWTRMG-UHFFFAOYSA-N.
| Molecular formula | C6HBrCl2FI |
|---|---|
| Molecular weight | 369.78 g/mol |
| IUPAC name | 4-bromo-1,3-dichloro-2-fluoro-5-iodobenzene |
| InChIKey | JJZULRZPQWTRMG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1I)Br)Cl)F)Cl |
Computed by PubChem (NCBI)