CAS 1160574-42-4 is the registry number for 4-Bromo-2,3-dichlorobenzonitrile, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
4-bromo-2,3-dichlorobenzonitrile (CAS 1160574-42-4) is a chemical compound with the molecular formula C7H2BrCl2N and a molecular weight of 250.90 g/mol. IUPAC name: 4-bromo-2,3-dichlorobenzonitrile. InChIKey: DWXVYJNPNBJMCR-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2N |
|---|---|
| Molecular weight | 250.90 g/mol |
| IUPAC name | 4-bromo-2,3-dichlorobenzonitrile |
| InChIKey | DWXVYJNPNBJMCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)Cl)Cl)Br |
Computed by PubChem (NCBI)