CAS 1349717-20-9 appears in our catalog under these names: 4-Bromo-2,5-dichlorobenzonitrile, 95%, 4-Bromo-2,5-dichloro-benzonitrile, 4-Bromo-2,5-dichlorobenzonitrile, 95+%, 4-Bromo-2,5-dichlorobenzonitrile, 95%, 95%. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-bromo-2,5-dichlorobenzonitrile (CAS 1349717-20-9) is a chemical compound with the molecular formula C7H2BrCl2N and a molecular weight of 250.90 g/mol. IUPAC name: 4-bromo-2,5-dichlorobenzonitrile. InChIKey: KUWYYTMBHHOQHS-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2N |
|---|---|
| Molecular weight | 250.90 g/mol |
| IUPAC name | 4-bromo-2,5-dichlorobenzonitrile |
| InChIKey | KUWYYTMBHHOQHS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Br)Cl)C#N |
Computed by PubChem (NCBI)