CAS 1160574-96-8 appears in our catalog under these names: 1,3-Dibromo-2-chloro-5-(trifluoromethoxy)benzene, 95%, 1,3-Dibromo-2-chloro-5-(trifluoromethoxy)benzene, ≥95%, ≥95%, 1,3-Dibromo-2-chloro-5-(trifluoromethoxy)benzene. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
1,3-dibromo-2-chloro-5-(trifluoromethoxy)benzene (CAS 1160574-96-8) is a chemical compound with the molecular formula C7H2Br2ClF3O and a molecular weight of 354.34 g/mol. IUPAC name: 1,3-dibromo-2-chloro-5-(trifluoromethoxy)benzene. InChIKey: CSRRRPRAILJYON-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2ClF3O |
|---|---|
| Molecular weight | 354.34 g/mol |
| IUPAC name | 1,3-dibromo-2-chloro-5-(trifluoromethoxy)benzene |
| InChIKey | CSRRRPRAILJYON-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)Cl)Br)OC(F)(F)F |
Computed by PubChem (NCBI)