Products 2918960-33-3
CAS 2918960-33-3 is the registry number for 2,6-dibromo-4-chloro-3-(trifluoromethyl)phenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-dibromo-4-chloro-3-(trifluoromethyl)phenol (CAS 2918960-33-3) is a chemical compound with the molecular formula C7H2Br2ClF3O and a molecular weight of 354.34 g/mol. IUPAC name: 2,6-dibromo-4-chloro-3-(trifluoromethyl)phenol. InChIKey: DBSLXCGCFGCKOO-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2ClF3O |
|---|---|
| Molecular weight | 354.34 g/mol |
| IUPAC name | 2,6-dibromo-4-chloro-3-(trifluoromethyl)phenol |
| InChIKey | DBSLXCGCFGCKOO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)O)Br)C(F)(F)F)Cl |
Computed by PubChem (NCBI)