Products 1160699-36-4

CAS 1160699-36-4 is the registry number for 2-(Cyclopentylformamido)-3-hydroxybutanoic acid. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.

Structural formula: {0} (CAS {1})

2-(cyclopentanecarbonylamino)-3-hydroxybutanoic acid (CAS 1160699-36-4) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 2-(cyclopentanecarbonylamino)-3-hydroxybutanoic acid. InChIKey: RPJWLGFMJLULLF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO4
Molecular weight215.25 g/mol
IUPAC name2-(cyclopentanecarbonylamino)-3-hydroxybutanoic acid
InChIKeyRPJWLGFMJLULLF-UHFFFAOYSA-N
SMILESCC(C(C(=O)O)NC(=O)C1CCCC1)O

Computed by PubChem (NCBI)