CAS 116129-08-9 is the registry number for (1s,3s)-1-aminocyclobutane-1,3-dicarboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-aminocyclobutane-1,3-dicarboxylic acid;hydrochloride (CAS 116129-08-9) is a chemical compound with the molecular formula C6H10ClNO4 and a molecular weight of 195.60 g/mol. IUPAC name: 1-aminocyclobutane-1,3-dicarboxylic acid;hydrochloride. InChIKey: VUKJBSWMLAPJGZ-UHFFFAOYSA-N.
| Molecular formula | C6H10ClNO4 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 1-aminocyclobutane-1,3-dicarboxylic acid;hydrochloride |
| InChIKey | VUKJBSWMLAPJGZ-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C(=O)O)N)C(=O)O.Cl |
Computed by PubChem (NCBI)