Products 1706418-84-9

CAS 1706418-84-9 is the registry number for Pyrrolidine-2,3-dicarboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Pyrrolidine-2,3-dicarboxylic acid;hydrochloride (CAS 1706418-84-9) is a chemical compound with the molecular formula C6H10ClNO4 and a molecular weight of 195.60 g/mol. IUPAC name: pyrrolidine-2,3-dicarboxylic acid;hydrochloride. InChIKey: BENFDRYXDLXALL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10ClNO4
Molecular weight195.60 g/mol
IUPAC namepyrrolidine-2,3-dicarboxylic acid;hydrochloride
InChIKeyBENFDRYXDLXALL-UHFFFAOYSA-N
SMILESC1CNC(C1C(=O)O)C(=O)O.Cl

Computed by PubChem (NCBI)