CAS 116173-67-2 appears in our catalog under these names: Beta-Alanine-2,2,3,3-D4, >95% (HPLC), beta-Alanine-2,2,3,3-d4, 98 atom % D, min 98% Chemical Purity, B–ALANINE–2,2,3,3–D4, β-Alanine-d4, 99.90%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 500mg, 0,25g, 0,1g, 25mg, 10 mg, 1 mg.
3-amino-2,2,3,3-tetradeuteriopropanoic acid (CAS 116173-67-2) is a chemical compound with the molecular formula C3H7NO2 and a molecular weight of 93.12 g/mol. IUPAC name: 3-amino-2,2,3,3-tetradeuteriopropanoic acid. InChIKey: UCMIRNVEIXFBKS-LNLMKGTHSA-N.
| Molecular formula | C3H7NO2 |
|---|---|
| Molecular weight | 93.12 g/mol |
| IUPAC name | 3-amino-2,2,3,3-tetradeuteriopropanoic acid |
| InChIKey | UCMIRNVEIXFBKS-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])N |
Computed by PubChem (NCBI)