CAS 1162-56-7 appears in our catalog under these names: Progesterone EP Impurity H, 6-Dehydroprogesterone, >95% (HPLC), Progesterone EP Impurity H (Dydrogesterone EP Impurity B), Pregna–4,6–diene–3,20–dione, 6-Dehydroprogesterone. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 25mg, 1g, 25g, 5g, 10g, 50g.
(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (CAS 1162-56-7) is a chemical compound with the molecular formula C21H28O2 and a molecular weight of 312.4 g/mol. IUPAC name: (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one. InChIKey: JGMOKGBVKVMRFX-LEKSSAKUSA-N.
| Molecular formula | C21H28O2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| InChIKey | JGMOKGBVKVMRFX-LEKSSAKUSA-N |
| SMILES | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C=CC4=CC(=O)CC[C@]34C)C |
Computed by PubChem (NCBI)