CAS 2444-24-8 is the registry number for 4-(Benzyloxy)-2,6-di-tert-butylphenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-ditert-butyl-4-phenylmethoxyphenol (CAS 2444-24-8) is a chemical compound with the molecular formula C21H28O2 and a molecular weight of 312.4 g/mol. IUPAC name: 2,6-ditert-butyl-4-phenylmethoxyphenol. InChIKey: CEUKUGJQGCPSQF-UHFFFAOYSA-N.
| Molecular formula | C21H28O2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-phenylmethoxyphenol |
| InChIKey | CEUKUGJQGCPSQF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)