CAS 116233-20-6 appears in our catalog under these names: 3-Bromo-5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-amine, 95%, 3-Bromo-5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine (CAS 116233-20-6) is a chemical compound with the molecular formula C14H20BrN and a molecular weight of 282.22 g/mol. IUPAC name: 3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine. InChIKey: JOVFUMDICFXFBG-UHFFFAOYSA-N.
| Molecular formula | C14H20BrN |
|---|---|
| Molecular weight | 282.22 g/mol |
| IUPAC name | 3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine |
| InChIKey | JOVFUMDICFXFBG-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=CC(=C(C=C21)N)Br)(C)C)C |
Computed by PubChem (NCBI)