CAS 1200130-95-5 is the registry number for rel-(2S,6R)-1-(4-Bromobenzyl)-2,6-dimethylpiperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,6R)-1-[(4-bromophenyl)methyl]-2,6-dimethylpiperidine (CAS 1200130-95-5) is a chemical compound with the molecular formula C14H20BrN and a molecular weight of 282.22 g/mol. IUPAC name: (2S,6R)-1-[(4-bromophenyl)methyl]-2,6-dimethylpiperidine. InChIKey: PIGIKHPZCSTRDF-TXEJJXNPSA-N.
| Molecular formula | C14H20BrN |
|---|---|
| Molecular weight | 282.22 g/mol |
| IUPAC name | (2S,6R)-1-[(4-bromophenyl)methyl]-2,6-dimethylpiperidine |
| InChIKey | PIGIKHPZCSTRDF-TXEJJXNPSA-N |
| SMILES | C[C@@H]1CCC[C@@H](N1CC2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)