Products 1162658-05-0
CAS 1162658-05-0 appears in our catalog under these names: 3,4-Dimethoxybenzaldehyde-d6, >95% (GC), 3,4-Dimethoxy-benzaldehyde-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 1g, 100 mg, 1 g.
3,4-bis(trideuteriomethoxy)benzaldehyde (CAS 1162658-05-0) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 172.21 g/mol. IUPAC name: 3,4-bis(trideuteriomethoxy)benzaldehyde. InChIKey: WJUFSDZVCOTFON-WFGJKAKNSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 172.21 g/mol |
| IUPAC name | 3,4-bis(trideuteriomethoxy)benzaldehyde |
| InChIKey | WJUFSDZVCOTFON-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C=O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)