CAS 1173022-44-0 appears in our catalog under these names: 3,4-Dimethoxy[7-13C]-benzaldehyde, 98% 98%atom%13C, 3,4-Dimethoxy(7-13C)-benzaldehyde, Veratraldehyde-13C. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 50mg, 5mg, 50 mg, 5 mg.
3,4-dimethoxy(13C)benzaldehyde (CAS 1173022-44-0) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 167.17 g/mol. IUPAC name: 3,4-dimethoxy(13C)benzaldehyde. InChIKey: WJUFSDZVCOTFON-PTQBSOBMSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 167.17 g/mol |
| IUPAC name | 3,4-dimethoxy(13C)benzaldehyde |
| InChIKey | WJUFSDZVCOTFON-PTQBSOBMSA-N |
| SMILES | COC1=C(C=C(C=C1)[13CH]=O)OC |
Computed by PubChem (NCBI)