Products 1162658-12-9
CAS 1162658-12-9 appears in our catalog under these names: Veratric Acid-d6, Veratric Acid-d6, >95% (HPLC). Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 100 mg, 10 mg.
3,4-bis(trideuteriomethoxy)benzoic acid (CAS 1162658-12-9) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 188.21 g/mol. IUPAC name: 3,4-bis(trideuteriomethoxy)benzoic acid. InChIKey: DAUAQNGYDSHRET-WFGJKAKNSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 188.21 g/mol |
| IUPAC name | 3,4-bis(trideuteriomethoxy)benzoic acid |
| InChIKey | DAUAQNGYDSHRET-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C(=O)O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)