Products 1163135-92-9
CAS 1163135-92-9 appears in our catalog under these names: Bimatoprost Impurity 1, (15R)-Isomer Bimatoprost, 15-epi Bimatoprost ((15R)-Bimatoprost), (15R)-Bimatoprost, >95% (HPLC), 15(R)–17–phenyl trinor Prostaglandin F2α ethyl amide. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 10mg, 1mg, 5mg, 500μg, 2mg, 25mg, 500 μg.
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-ethylhept-5-enamide (CAS 1163135-92-9) is a chemical compound with the molecular formula C25H37NO4 and a molecular weight of 415.6 g/mol. IUPAC name: (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-ethylhept-5-enamide. InChIKey: AQOKCDNYWBIDND-ZPFRTTICSA-N.
| Molecular formula | C25H37NO4 |
|---|---|
| Molecular weight | 415.6 g/mol |
| IUPAC name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-ethylhept-5-enamide |
| InChIKey | AQOKCDNYWBIDND-ZPFRTTICSA-N |
| SMILES | CCNC(=O)CCC/C=C\C[C@H]1[C@H](C[C@H]([C@@H]1/C=C/[C@@H](CCC2=CC=CC=C2)O)O)O |
Computed by PubChem (NCBI)