Products 497063-94-2
CAS 497063-94-2 appears in our catalog under these names: Salmeterol-d3, (±)-Salmeterol-d3 (3-hydroxymethyl-d2, alpha-d1), 98 atom % D, min 98% Chemical Purity, Salmeterol D3, Salmeterol-d3, >95% (HPLC), Salmeterol–d3. Offered by: Chemat Brand, CDN, Dr. Ehrenstorfer, TRC, GLPBio. Available pack sizes: on request, 0,01g, 0,005g, 10mg, 1mg, 5mg, 1x5mg, 1x1ml.
4-[1-deuterio-1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]-2-[dideuterio(hydroxy)methyl]phenol (CAS 497063-94-2) is a chemical compound with the molecular formula C25H37NO4 and a molecular weight of 418.6 g/mol. IUPAC name: 4-[1-deuterio-1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]-2-[dideuterio(hydroxy)methyl]phenol. InChIKey: GIIZNNXWQWCKIB-LPUTUNIKSA-N.
| Molecular formula | C25H37NO4 |
|---|---|
| Molecular weight | 418.6 g/mol |
| IUPAC name | 4-[1-deuterio-1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]-2-[dideuterio(hydroxy)methyl]phenol |
| InChIKey | GIIZNNXWQWCKIB-LPUTUNIKSA-N |
| SMILES | [2H]C([2H])(C1=C(C=CC(=C1)C([2H])(CNCCCCCCOCCCCC2=CC=CC=C2)O)O)O |
Computed by PubChem (NCBI)