Products 1163139-33-0
CAS 1163139-33-0 is the registry number for (4-(3-Chlorophenyl)piperazin-1-yl)(pyrrolidin-2-yl)methanone. Offered by: Biosynth. Available pack sizes: 5000mg.
[4-(3-chlorophenyl)piperazin-1-yl]-pyrrolidin-2-ylmethanone (CAS 1163139-33-0) is a chemical compound with the molecular formula C15H20ClN3O and a molecular weight of 293.79 g/mol. IUPAC name: [4-(3-chlorophenyl)piperazin-1-yl]-pyrrolidin-2-ylmethanone. InChIKey: BBOVDLDPCZRHEZ-UHFFFAOYSA-N.
| Molecular formula | C15H20ClN3O |
|---|---|
| Molecular weight | 293.79 g/mol |
| IUPAC name | [4-(3-chlorophenyl)piperazin-1-yl]-pyrrolidin-2-ylmethanone |
| InChIKey | BBOVDLDPCZRHEZ-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C(=O)N2CCN(CC2)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)