CAS 76738-64-2 is the registry number for Paclobutrazol Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol (CAS 76738-64-2) is a chemical compound with the molecular formula C15H20ClN3O and a molecular weight of 293.79 g/mol. IUPAC name: (2S,3R)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol. InChIKey: RMOGWMIKYWRTKW-KBPBESRZSA-N.
| Molecular formula | C15H20ClN3O |
|---|---|
| Molecular weight | 293.79 g/mol |
| IUPAC name | (2S,3R)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol |
| InChIKey | RMOGWMIKYWRTKW-KBPBESRZSA-N |
| SMILES | CC(C)(C)[C@H]([C@H](CC1=CC=C(C=C1)Cl)N2C=NC=N2)O |
Computed by PubChem (NCBI)