CAS 1163294-17-4 is the registry number for Atovaquone-d4. Offered by: TRC. Available pack sizes: 25mg.
3-[4-(4-chloro-2,3,5,6-tetradeuteriophenyl)cyclohexyl]-4-hydroxynaphthalene-1,2-dione (CAS 1163294-17-4) is a chemical compound with the molecular formula C22H19ClO3 and a molecular weight of 370.9 g/mol. IUPAC name: 3-[4-(4-chloro-2,3,5,6-tetradeuteriophenyl)cyclohexyl]-4-hydroxynaphthalene-1,2-dione. InChIKey: BSJMWHQBCZFXBR-IRYCTXJYSA-N.
| Molecular formula | C22H19ClO3 |
|---|---|
| Molecular weight | 370.9 g/mol |
| IUPAC name | 3-[4-(4-chloro-2,3,5,6-tetradeuteriophenyl)cyclohexyl]-4-hydroxynaphthalene-1,2-dione |
| InChIKey | BSJMWHQBCZFXBR-IRYCTXJYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2CCC(CC2)C3=C(C4=CC=CC=C4C(=O)C3=O)O)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)