CAS 1217612-80-0 is the registry number for cis-Atovaquone-d5 (contains 10% trans isomer). Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 5 mg, 1 mg, 500 μg.
3-[4-(4-chlorophenyl)-1,2,2,6,6-pentadeuteriocyclohexyl]-4-hydroxynaphthalene-1,2-dione (CAS 1217612-80-0) is a chemical compound with the molecular formula C22H19ClO3 and a molecular weight of 371.9 g/mol. IUPAC name: 3-[4-(4-chlorophenyl)-1,2,2,6,6-pentadeuteriocyclohexyl]-4-hydroxynaphthalene-1,2-dione. InChIKey: BSJMWHQBCZFXBR-YNUDWXFUSA-N.
| Molecular formula | C22H19ClO3 |
|---|---|
| Molecular weight | 371.9 g/mol |
| IUPAC name | 3-[4-(4-chlorophenyl)-1,2,2,6,6-pentadeuteriocyclohexyl]-4-hydroxynaphthalene-1,2-dione |
| InChIKey | BSJMWHQBCZFXBR-YNUDWXFUSA-N |
| SMILES | [2H]C1(CC(CC(C1([2H])C2=C(C3=CC=CC=C3C(=O)C2=O)O)([2H])[2H])C4=CC=C(C=C4)Cl)[2H] |
Computed by PubChem (NCBI)