CAS 116366-11-1 is the registry number for 1-Chloro-10H-phenoxazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-10H-phenoxazine (CAS 116366-11-1) is a chemical compound with the molecular formula C12H8ClNO and a molecular weight of 217.65 g/mol. IUPAC name: 1-chloro-10H-phenoxazine. InChIKey: ZFNHVQFLFYDPCY-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 1-chloro-10H-phenoxazine |
| InChIKey | ZFNHVQFLFYDPCY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(O2)C=CC=C3Cl |
Computed by PubChem (NCBI)