Products 116366-27-9
CAS 116366-27-9 is the registry number for N-Boc-4-nitro-L-phenylalanine t-butyl ester. Offered by: Biosynth. Available pack sizes: 5000mg.
Tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoate (CAS 116366-27-9) is a chemical compound with the molecular formula C18H26N2O6 and a molecular weight of 366.4 g/mol. IUPAC name: tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoate. InChIKey: CIIPFNPETNNJDS-AWEZNQCLSA-N.
| Molecular formula | C18H26N2O6 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoate |
| InChIKey | CIIPFNPETNNJDS-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)