Products 52-88-0
CAS 52-88-0 appears in our catalog under these names: Methylatropine (nitrate), Methylatropine (nitrate), Atropine methyl (nitrate), 99.77%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 10 mg, 25 mg, 5 mg.
[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate nitrate (CAS 52-88-0) is a chemical compound with the molecular formula C18H26N2O6 and a molecular weight of 366.4 g/mol. IUPAC name: [(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate nitrate. InChIKey: NEDVJZNVOSNSHF-ZNHDNBJUSA-N.
| Molecular formula | C18H26N2O6 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | [(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate nitrate |
| InChIKey | NEDVJZNVOSNSHF-ZNHDNBJUSA-N |
| SMILES | C[N+]1([C@@H]2CC[C@H]1CC(C2)OC(=O)C(CO)C3=CC=CC=C3)C.[N+](=O)([O-])[O-] |
Computed by PubChem (NCBI)