Products 116367-67-0
CAS 116367-67-0 is the registry number for 4-Bromo-2-fluoro-5-(trifluoromethoxy)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-2-fluoro-5-(trifluoromethoxy)aniline (CAS 116367-67-0) is a chemical compound with the molecular formula C7H4BrF4NO and a molecular weight of 274.01 g/mol. IUPAC name: 4-bromo-2-fluoro-5-(trifluoromethoxy)aniline. InChIKey: KCUDKOAKLVMESG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF4NO |
|---|---|
| Molecular weight | 274.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-5-(trifluoromethoxy)aniline |
| InChIKey | KCUDKOAKLVMESG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1OC(F)(F)F)Br)F)N |
Computed by PubChem (NCBI)