Products 2377032-36-3
CAS 2377032-36-3 is the registry number for 5-Bromo-2-fluoro-3-(2,2,2-trifluoroethoxy)pyridine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-bromo-2-fluoro-3-(2,2,2-trifluoroethoxy)pyridine (CAS 2377032-36-3) is a chemical compound with the molecular formula C7H4BrF4NO and a molecular weight of 274.01 g/mol. IUPAC name: 5-bromo-2-fluoro-3-(2,2,2-trifluoroethoxy)pyridine. InChIKey: OSBVFFGJTWAJAQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF4NO |
|---|---|
| Molecular weight | 274.01 g/mol |
| IUPAC name | 5-bromo-2-fluoro-3-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | OSBVFFGJTWAJAQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1OCC(F)(F)F)F)Br |
Computed by PubChem (NCBI)