Products 116370-29-7
CAS 116370-29-7 is the registry number for Ro 19-9638. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[hydroxy(methyl)amino]-N-[4-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phenyl]propanamide (CAS 116370-29-7) is a chemical compound with the molecular formula C15H19N5O5 and a molecular weight of 349.34 g/mol. IUPAC name: 2-[hydroxy(methyl)amino]-N-[4-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phenyl]propanamide. InChIKey: OXRATBZYZYGARK-UHFFFAOYSA-N.
| Molecular formula | C15H19N5O5 |
|---|---|
| Molecular weight | 349.34 g/mol |
| IUPAC name | 2-[hydroxy(methyl)amino]-N-[4-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phenyl]propanamide |
| InChIKey | OXRATBZYZYGARK-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC=C(C=C1)OCC2=CN=C(N2C)[N+](=O)[O-])N(C)O |
Computed by PubChem (NCBI)
Synonyms:
Ro 19-9638, Ro-19-9638