CAS 1163706-98-6 appears in our catalog under these names: Methyl (4r)-4-(dimethylamino)-l-prolinate dihydrochloride, 95%, (2S,4R)-Methyl 4-(dimethylamino)pyrrolidine-2-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl (2S,4R)-4-(dimethylamino)pyrrolidine-2-carboxylate (CAS 1163706-98-6) is a chemical compound with the molecular formula C8H16N2O2 and a molecular weight of 172.22 g/mol. IUPAC name: methyl (2S,4R)-4-(dimethylamino)pyrrolidine-2-carboxylate. InChIKey: QJZKXMHMKDYEDH-RQJHMYQMSA-N.
| Molecular formula | C8H16N2O2 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | methyl (2S,4R)-4-(dimethylamino)pyrrolidine-2-carboxylate |
| InChIKey | QJZKXMHMKDYEDH-RQJHMYQMSA-N |
| SMILES | CN(C)[C@@H]1C[C@H](NC1)C(=O)OC |
Computed by PubChem (NCBI)