Products 1163707-59-2
CAS 1163707-59-2 is the registry number for 1-(4-Bromopyridin-2-yl)cyclobutanecarbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-bromo-2-pyridinyl)cyclobutane-1-carbonitrile (CAS 1163707-59-2) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 1-(4-bromo-2-pyridinyl)cyclobutane-1-carbonitrile. InChIKey: WXQKLBXTWCBKHN-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 1-(4-bromo-2-pyridinyl)cyclobutane-1-carbonitrile |
| InChIKey | WXQKLBXTWCBKHN-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C#N)C2=NC=CC(=C2)Br |
Computed by PubChem (NCBI)