Products 1164471-66-2
CAS 1164471-66-2 is the registry number for 2-Oxo-2-(3-oxo-3,4-dihydroquinoxalin-1(2H)-yl)ethyl (E)-3-(4-methoxyphenyl)acrylate, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (CAS 1164471-66-2) is a chemical compound with the molecular formula C20H18N2O5 and a molecular weight of 366.4 g/mol. IUPAC name: [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate. InChIKey: JUZIBSGTGYEVQP-DHZHZOJOSA-N.
| Molecular formula | C20H18N2O5 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| InChIKey | JUZIBSGTGYEVQP-DHZHZOJOSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)OCC(=O)N2CC(=O)NC3=CC=CC=C32 |
Computed by PubChem (NCBI)