Products 808120-20-9

CAS 808120-20-9 is the registry number for Roxadustat Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(1-ethyl-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl)amino]acetic acid (CAS 808120-20-9) is a chemical compound with the molecular formula C20H18N2O5 and a molecular weight of 366.4 g/mol. IUPAC name: 2-[(1-ethyl-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl)amino]acetic acid. InChIKey: ZJSHQZAFIQIXIE-UHFFFAOYSA-N.

Identity
Molecular formulaC20H18N2O5
Molecular weight366.4 g/mol
IUPAC name2-[(1-ethyl-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl)amino]acetic acid
InChIKeyZJSHQZAFIQIXIE-UHFFFAOYSA-N
SMILESCCC1=NC(=C(C2=C1C=C(C=C2)OC3=CC=CC=C3)O)C(=O)NCC(=O)O

Computed by PubChem (NCBI)