CAS 808120-20-9 is the registry number for Roxadustat Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1-ethyl-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl)amino]acetic acid (CAS 808120-20-9) is a chemical compound with the molecular formula C20H18N2O5 and a molecular weight of 366.4 g/mol. IUPAC name: 2-[(1-ethyl-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl)amino]acetic acid. InChIKey: ZJSHQZAFIQIXIE-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O5 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 2-[(1-ethyl-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl)amino]acetic acid |
| InChIKey | ZJSHQZAFIQIXIE-UHFFFAOYSA-N |
| SMILES | CCC1=NC(=C(C2=C1C=C(C=C2)OC3=CC=CC=C3)O)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)