Products 252212-58-1
CAS 252212-58-1 appears in our catalog under these names: GAPDH-IN-1, 98.1%, GAPDH Inhibitor Compound F8. Offered by: MedChemExpress, GLPBio. Available pack sizes: 5 mg, 1 mg, 1mg, 5mg.
2,5-bis[3-(oxiran-2-ylmethoxy)phenyl]-1,3,4-oxadiazole (CAS 252212-58-1) is a chemical compound with the molecular formula C20H18N2O5 and a molecular weight of 366.4 g/mol. IUPAC name: 2,5-bis[3-(oxiran-2-ylmethoxy)phenyl]-1,3,4-oxadiazole. InChIKey: IQCCNCOQRRJSTE-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O5 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 2,5-bis[3-(oxiran-2-ylmethoxy)phenyl]-1,3,4-oxadiazole |
| InChIKey | IQCCNCOQRRJSTE-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=CC=CC(=C2)C3=NN=C(O3)C4=CC(=CC=C4)OCC5CO5 |
Computed by PubChem (NCBI)